C11H13ClF3NO3S — CID 115522640
2-chloro-5-(hydroxymethyl)-N-(4,4,4-trifluorobutyl)benzenesulfonamide (PubChem CID 115522640) has the molecular formula C11H13ClF3NO3S and a molecular weight of 331.74 g/mol. Its IUPAC name is 2-chloro-5-(hydroxymethyl)-N-(4,4,4-trifluorobutyl)benzenesulfonamide.
| Compound Name | 2-chloro-5-(hydroxymethyl)-N-(4,4,4-trifluorobutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115522640 |
| Molecular Formula | C11H13ClF3NO3S |
| Molecular Weight | 331.74 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 2-chloro-5-(hydroxymethyl)-N-(4,4,4-trifluorobutyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCCC(F)(F)F)c1cc(CO)ccc1Cl |
| InChI | InChI=1S/C11H13ClF3NO3S/c12-9-3-2-8(7-17)6-10(9)20(18,19)16-5-1-4-11(13,14)15/h2-3,6,16-17H,1,4-5,7H2 |
| InChIKey | WCLVDVFJFPQLDA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.74 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|