C11H10Cl2F3NO3S — CID 115522582
2-chloro-5-(4,4,4-trifluorobutylcarbamoyl)benzenesulfonyl chloride (PubChem CID 115522582) has the molecular formula C11H10Cl2F3NO3S and a molecular weight of 364.17 g/mol. Its IUPAC name is 2-chloro-5-(4,4,4-trifluorobutylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 2-chloro-5-(4,4,4-trifluorobutylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 115522582 |
| Molecular Formula | C11H10Cl2F3NO3S |
| Molecular Weight | 364.17 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | 2-chloro-5-(4,4,4-trifluorobutylcarbamoyl)benzenesulfonyl chloride |
| SMILES | O=C(NCCCC(F)(F)F)c1ccc(Cl)c(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C11H10Cl2F3NO3S/c12-8-3-2-7(6-9(8)21(13,19)20)10(18)17-5-1-4-11(14,15)16/h2-3,6H,1,4-5H2,(H,17,18) |
| InChIKey | DXIGXVHOZPEBTK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.17 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|