C10H11F3N2O2 — CID 103766068
2-oxo-N-(4,4,4-trifluorobutyl)-1H-pyridine-4-carboxamide (PubChem CID 103766068) has the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. Its IUPAC name is 2-oxo-N-(4,4,4-trifluorobutyl)-1H-pyridine-4-carboxamide.
| Compound Name | 2-oxo-N-(4,4,4-trifluorobutyl)-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 103766068 |
| Molecular Formula | C10H11F3N2O2 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 2-oxo-N-(4,4,4-trifluorobutyl)-1H-pyridine-4-carboxamide |
| SMILES | O=C(NCCCC(F)(F)F)c1cc[nH]c(=O)c1 |
| InChI | InChI=1S/C10H11F3N2O2/c11-10(12,13)3-1-4-15-9(17)7-2-5-14-8(16)6-7/h2,5-6H,1,3-4H2,(H,14,16)(H,15,17) |
| InChIKey | HMFPTFRXEYYCGT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|