C11H15BrN2O2 — CID 106130813
N-(4-bromopentyl)-2-oxo-1H-pyridine-4-carboxamide (PubChem CID 106130813) has the molecular formula C11H15BrN2O2 and a molecular weight of 287.16 g/mol. Its IUPAC name is N-(4-bromopentyl)-2-oxo-1H-pyridine-4-carboxamide.
| Compound Name | N-(4-bromopentyl)-2-oxo-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 106130813 |
| Molecular Formula | C11H15BrN2O2 |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | N-(4-bromopentyl)-2-oxo-1H-pyridine-4-carboxamide |
| SMILES | CC(Br)CCCNC(=O)c1cc[nH]c(=O)c1 |
| InChI | InChI=1S/C11H15BrN2O2/c1-8(12)3-2-5-14-11(16)9-4-6-13-10(15)7-9/h4,6-8H,2-3,5H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | DPIGNSUETGVILV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|