C13H18BrNO4S — CID 106002108
2-bromo-4-(hydroxymethyl)-N-[2-(oxolan-3-yl)ethyl]benzenesulfonamide (PubChem CID 106002108) has the molecular formula C13H18BrNO4S and a molecular weight of 364.26 g/mol. Its IUPAC name is 2-bromo-4-(hydroxymethyl)-N-[2-(oxolan-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 2-bromo-4-(hydroxymethyl)-N-[2-(oxolan-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106002108 |
| Molecular Formula | C13H18BrNO4S |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 2-bromo-4-(hydroxymethyl)-N-[2-(oxolan-3-yl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCC1CCOC1)c1ccc(CO)cc1Br |
| InChI | InChI=1S/C13H18BrNO4S/c14-12-7-11(8-16)1-2-13(12)20(17,18)15-5-3-10-4-6-19-9-10/h1-2,7,10,15-16H,3-6,8-9H2 |
| InChIKey | AOBWKBRHNUPSQI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |