C14H21NO5S — CID 106002086
5-(hydroxymethyl)-2-methoxy-N-[2-(oxolan-3-yl)ethyl]benzenesulfonamide (PubChem CID 106002086) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-methoxy-N-[2-(oxolan-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 5-(hydroxymethyl)-2-methoxy-N-[2-(oxolan-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106002086 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 5-(hydroxymethyl)-2-methoxy-N-[2-(oxolan-3-yl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(CO)cc1S(=O)(=O)NCCC1CCOC1 |
| InChI | InChI=1S/C14H21NO5S/c1-19-13-3-2-12(9-16)8-14(13)21(17,18)15-6-4-11-5-7-20-10-11/h2-3,8,11,15-16H,4-7,9-10H2,1H3 |
| InChIKey | PNOLCNHIHROVEZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |