C14H21FN2O3S — CID 106092820
2-fluoro-5-(methylaminomethyl)-N-[2-(oxolan-3-yl)ethyl]benzenesulfonamide (PubChem CID 106092820) has the molecular formula C14H21FN2O3S and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-fluoro-5-(methylaminomethyl)-N-[2-(oxolan-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 2-fluoro-5-(methylaminomethyl)-N-[2-(oxolan-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106092820 |
| Molecular Formula | C14H21FN2O3S |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 2-fluoro-5-(methylaminomethyl)-N-[2-(oxolan-3-yl)ethyl]benzenesulfonamide |
| SMILES | CNCc1ccc(F)c(S(=O)(=O)NCCC2CCOC2)c1 |
| InChI | InChI=1S/C14H21FN2O3S/c1-16-9-12-2-3-13(15)14(8-12)21(18,19)17-6-4-11-5-7-20-10-11/h2-3,8,11,16-17H,4-7,9-10H2,1H3 |
| InChIKey | RAYUUDDRLBIZNR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |