C13H17Br2NO — CID 113415247
N-[(3,4-dibromophenyl)methyl]-2-(oxolan-3-yl)ethanamine (PubChem CID 113415247) has the molecular formula C13H17Br2NO and a molecular weight of 363.09 g/mol. Its IUPAC name is N-[(3,4-dibromophenyl)methyl]-2-(oxolan-3-yl)ethanamine.
| Compound Name | N-[(3,4-dibromophenyl)methyl]-2-(oxolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 113415247 |
| Molecular Formula | C13H17Br2NO |
| Molecular Weight | 363.09 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | N-[(3,4-dibromophenyl)methyl]-2-(oxolan-3-yl)ethanamine |
| SMILES | Brc1ccc(CNCCC2CCOC2)cc1Br |
| InChI | InChI=1S/C13H17Br2NO/c14-12-2-1-11(7-13(12)15)8-16-5-3-10-4-6-17-9-10/h1-2,7,10,16H,3-6,8-9H2 |
| InChIKey | LULVOTJEORNXRQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.09 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|