C10H10N4O4S2 — CID 29031266
methyl 3-amino-4-(1,3,4-thiadiazol-2-ylsulfamoyl)benzoate (PubChem CID 29031266) has the molecular formula C10H10N4O4S2 and a molecular weight of 314.35 g/mol. Its IUPAC name is methyl 3-amino-4-(1,3,4-thiadiazol-2-ylsulfamoyl)benzoate.
| Compound Name | methyl 3-amino-4-(1,3,4-thiadiazol-2-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 29031266 |
| Molecular Formula | C10H10N4O4S2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | methyl 3-amino-4-(1,3,4-thiadiazol-2-ylsulfamoyl)benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)Nc2nncs2)c(N)c1 |
| InChI | InChI=1S/C10H10N4O4S2/c1-18-9(15)6-2-3-8(7(11)4-6)20(16,17)14-10-13-12-5-19-10/h2-5H,11H2,1H3,(H,13,14) |
| InChIKey | NETSUKGCOBSTDO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|