C11H12N2O4S — CID 61111198
methyl 3-amino-4-(prop-2-ynylsulfamoyl)benzoate (PubChem CID 61111198) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is methyl 3-amino-4-(prop-2-ynylsulfamoyl)benzoate.
| Compound Name | methyl 3-amino-4-(prop-2-ynylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 61111198 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | methyl 3-amino-4-(prop-2-ynylsulfamoyl)benzoate |
| SMILES | C#CCNS(=O)(=O)c1ccc(C(=O)OC)cc1N |
| InChI | InChI=1S/C11H12N2O4S/c1-3-6-13-18(15,16)10-5-4-8(7-9(10)12)11(14)17-2/h1,4-5,7,13H,6,12H2,2H3 |
| InChIKey | FGPFCTOMGHLODH-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|