C11H14F2N2O5S — CID 106165680
methyl 3-amino-4-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]benzoate (PubChem CID 106165680) has the molecular formula C11H14F2N2O5S and a molecular weight of 324.31 g/mol. Its IUPAC name is methyl 3-amino-4-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]benzoate.
| Compound Name | methyl 3-amino-4-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 106165680 |
| Molecular Formula | C11H14F2N2O5S |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | methyl 3-amino-4-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCC(F)(F)CO)c(N)c1 |
| InChI | InChI=1S/C11H14F2N2O5S/c1-20-10(17)7-2-3-9(8(14)4-7)21(18,19)15-5-11(12,13)6-16/h2-4,15-16H,5-6,14H2,1H3 |
| InChIKey | OSPJLGGHVDZUBH-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|