C9H8ClN3O2S2 — CID 75389570
2-chloro-4-methyl-N-(1,3,4-thiadiazol-2-yl)benzenesulfonamide (PubChem CID 75389570) has the molecular formula C9H8ClN3O2S2 and a molecular weight of 289.77 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-(1,3,4-thiadiazol-2-yl)benzenesulfonamide.
| Compound Name | 2-chloro-4-methyl-N-(1,3,4-thiadiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 75389570 |
| Molecular Formula | C9H8ClN3O2S2 |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 288.97 |
| IUPAC Name | 2-chloro-4-methyl-N-(1,3,4-thiadiazol-2-yl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2nncs2)c(Cl)c1 |
| InChI | InChI=1S/C9H8ClN3O2S2/c1-6-2-3-8(7(10)4-6)17(14,15)13-9-12-11-5-16-9/h2-5H,1H3,(H,12,13) |
| InChIKey | WHIVSIXBJNRTEK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |