C12H8ClN3O2S2 — CID 25042460
8-chloro-N-(1,3,4-thiadiazol-2-yl)naphthalene-1-sulfonamide (PubChem CID 25042460) has the molecular formula C12H8ClN3O2S2 and a molecular weight of 325.80 g/mol. Its IUPAC name is 8-chloro-N-(1,3,4-thiadiazol-2-yl)naphthalene-1-sulfonamide.
| Compound Name | 8-chloro-N-(1,3,4-thiadiazol-2-yl)naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 25042460 |
| Molecular Formula | C12H8ClN3O2S2 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | 8-chloro-N-(1,3,4-thiadiazol-2-yl)naphthalene-1-sulfonamide |
| SMILES | O=S(=O)(Nc1nncs1)c1cccc2cccc(Cl)c12 |
| InChI | InChI=1S/C12H8ClN3O2S2/c13-9-5-1-3-8-4-2-6-10(11(8)9)20(17,18)16-12-15-14-7-19-12/h1-7H,(H,15,16) |
| InChIKey | XEHQCMYMABEUDJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |