C8H5F2N3O2S2 — CID 163353225
2,6-difluoro-N-(1,3,4-thiadiazol-2-yl)benzenesulfonamide (PubChem CID 163353225) has the molecular formula C8H5F2N3O2S2 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2,6-difluoro-N-(1,3,4-thiadiazol-2-yl)benzenesulfonamide.
| Compound Name | 2,6-difluoro-N-(1,3,4-thiadiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 163353225 |
| Molecular Formula | C8H5F2N3O2S2 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | 2,6-difluoro-N-(1,3,4-thiadiazol-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nncs1)c1c(F)cccc1F |
| InChI | InChI=1S/C8H5F2N3O2S2/c9-5-2-1-3-6(10)7(5)17(14,15)13-8-12-11-4-16-8/h1-4H,(H,12,13) |
| InChIKey | YSGDEMBIALJGNK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |