C9H8ClN3O3S2 — CID 163351568
3-chloro-4-methoxy-N-(1,3,4-thiadiazol-2-yl)benzenesulfonamide (PubChem CID 163351568) has the molecular formula C9H8ClN3O3S2 and a molecular weight of 305.77 g/mol. Its IUPAC name is 3-chloro-4-methoxy-N-(1,3,4-thiadiazol-2-yl)benzenesulfonamide.
| Compound Name | 3-chloro-4-methoxy-N-(1,3,4-thiadiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 163351568 |
| Molecular Formula | C9H8ClN3O3S2 |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | 3-chloro-4-methoxy-N-(1,3,4-thiadiazol-2-yl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2nncs2)cc1Cl |
| InChI | InChI=1S/C9H8ClN3O3S2/c1-16-8-3-2-6(4-7(8)10)18(14,15)13-9-12-11-5-17-9/h2-5H,1H3,(H,12,13) |
| InChIKey | JYVWGFFZDCXNSE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |