C15H19ClN4O3S — CID 113044338
N-[6-(tert-butylamino)pyridazin-3-yl]-3-chloro-4-methoxybenzenesulfonamide (PubChem CID 113044338) has the molecular formula C15H19ClN4O3S and a molecular weight of 370.86 g/mol. Its IUPAC name is N-[6-(tert-butylamino)pyridazin-3-yl]-3-chloro-4-methoxybenzenesulfonamide.
| Compound Name | N-[6-(tert-butylamino)pyridazin-3-yl]-3-chloro-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 113044338 |
| Molecular Formula | C15H19ClN4O3S |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N-[6-(tert-butylamino)pyridazin-3-yl]-3-chloro-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(NC(C)(C)C)nn2)cc1Cl |
| InChI | InChI=1S/C15H19ClN4O3S/c1-15(2,3)17-13-7-8-14(19-18-13)20-24(21,22)10-5-6-12(23-4)11(16)9-10/h5-9H,1-4H3,(H,17,18)(H,19,20) |
| InChIKey | XITACJVMFXDQBN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |