C14H16Cl2N4O2S — CID 113044323
N-[6-(tert-butylamino)pyridazin-3-yl]-3,4-dichlorobenzenesulfonamide (PubChem CID 113044323) has the molecular formula C14H16Cl2N4O2S and a molecular weight of 375.28 g/mol. Its IUPAC name is N-[6-(tert-butylamino)pyridazin-3-yl]-3,4-dichlorobenzenesulfonamide.
| Compound Name | N-[6-(tert-butylamino)pyridazin-3-yl]-3,4-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 113044323 |
| Molecular Formula | C14H16Cl2N4O2S |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | N-[6-(tert-butylamino)pyridazin-3-yl]-3,4-dichlorobenzenesulfonamide |
| SMILES | CC(C)(C)Nc1ccc(NS(=O)(=O)c2ccc(Cl)c(Cl)c2)nn1 |
| InChI | InChI=1S/C14H16Cl2N4O2S/c1-14(2,3)17-12-6-7-13(19-18-12)20-23(21,22)9-4-5-10(15)11(16)8-9/h4-8H,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | VDZLSGIPZIYOKB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |