C11H13Br2NO3S — CID 82736291
2,4-dibromo-N-(2-methyloxolan-3-yl)benzenesulfonamide (PubChem CID 82736291) has the molecular formula C11H13Br2NO3S and a molecular weight of 399.10 g/mol. Its IUPAC name is 2,4-dibromo-N-(2-methyloxolan-3-yl)benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-(2-methyloxolan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 82736291 |
| Molecular Formula | C11H13Br2NO3S |
| Molecular Weight | 399.10 g/mol |
| Exact Mass | 396.90 |
| IUPAC Name | 2,4-dibromo-N-(2-methyloxolan-3-yl)benzenesulfonamide |
| SMILES | CC1OCCC1NS(=O)(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H13Br2NO3S/c1-7-10(4-5-17-7)14-18(15,16)11-3-2-8(12)6-9(11)13/h2-3,6-7,10,14H,4-5H2,1H3 |
| InChIKey | VKIFKKCKKDOXRZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.10 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |