C13H17F3N2O2S — CID 63258670
N-(2-aminocycloheptyl)-2,4,6-trifluorobenzenesulfonamide (PubChem CID 63258670) has the molecular formula C13H17F3N2O2S and a molecular weight of 322.35 g/mol. Its IUPAC name is N-(2-aminocycloheptyl)-2,4,6-trifluorobenzenesulfonamide.
| Compound Name | N-(2-aminocycloheptyl)-2,4,6-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 63258670 |
| Molecular Formula | C13H17F3N2O2S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-(2-aminocycloheptyl)-2,4,6-trifluorobenzenesulfonamide |
| SMILES | NC1CCCCCC1NS(=O)(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C13H17F3N2O2S/c14-8-6-9(15)13(10(16)7-8)21(19,20)18-12-5-3-1-2-4-11(12)17/h6-7,11-12,18H,1-5,17H2 |
| InChIKey | ZEDZHMWIRLZIRP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |