C12H12Cl3NO4S — CID 70196519
(2S)-1-[2,4-dichloro-3-(chloromethyl)phenyl]sulfonylpyrrolidine-2-carboxylic acid (PubChem CID 70196519) has the molecular formula C12H12Cl3NO4S and a molecular weight of 372.66 g/mol. Its IUPAC name is (2S)-1-[2,4-dichloro-3-(chloromethyl)phenyl]sulfonylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2,4-dichloro-3-(chloromethyl)phenyl]sulfonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70196519 |
| Molecular Formula | C12H12Cl3NO4S |
| Molecular Weight | 372.66 g/mol |
| Exact Mass | 370.96 |
| IUPAC Name | (2S)-1-[2,4-dichloro-3-(chloromethyl)phenyl]sulfonylpyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1S(=O)(=O)c1ccc(Cl)c(CCl)c1Cl |
| InChI | InChI=1S/C12H12Cl3NO4S/c13-6-7-8(14)3-4-10(11(7)15)21(19,20)16-5-1-2-9(16)12(17)18/h3-4,9H,1-2,5-6H2,(H,17,18)/t9-/m0/s1 |
| InChIKey | VCCKQMGPAGGLHA-VIFPVBQESA-N |
| XLogP | 2.97 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.66 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|