C10H9Cl2FN2O3S — CID 103088756
4-(2,4-dichloro-3-fluorophenyl)sulfonylpiperazin-2-one (PubChem CID 103088756) has the molecular formula C10H9Cl2FN2O3S and a molecular weight of 327.16 g/mol. Its IUPAC name is 4-(2,4-dichloro-3-fluorophenyl)sulfonylpiperazin-2-one.
| Compound Name | 4-(2,4-dichloro-3-fluorophenyl)sulfonylpiperazin-2-one |
|---|---|
| PubChem CID | 103088756 |
| Molecular Formula | C10H9Cl2FN2O3S |
| Molecular Weight | 327.16 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | 4-(2,4-dichloro-3-fluorophenyl)sulfonylpiperazin-2-one |
| SMILES | O=C1CN(S(=O)(=O)c2ccc(Cl)c(F)c2Cl)CCN1 |
| InChI | InChI=1S/C10H9Cl2FN2O3S/c11-6-1-2-7(9(12)10(6)13)19(17,18)15-4-3-14-8(16)5-15/h1-2H,3-5H2,(H,14,16) |
| InChIKey | CPBZLNPUMXQTDX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.16 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|