C17H24F3NO3S — CID 55691532
3-methyl-4-propan-2-yloxy-N-[3-(trifluoromethyl)cyclohexyl]benzenesulfonamide (PubChem CID 55691532) has the molecular formula C17H24F3NO3S and a molecular weight of 379.44 g/mol. Its IUPAC name is 3-methyl-4-propan-2-yloxy-N-[3-(trifluoromethyl)cyclohexyl]benzenesulfonamide.
| Compound Name | 3-methyl-4-propan-2-yloxy-N-[3-(trifluoromethyl)cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55691532 |
| Molecular Formula | C17H24F3NO3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 3-methyl-4-propan-2-yloxy-N-[3-(trifluoromethyl)cyclohexyl]benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2CCCC(C(F)(F)F)C2)ccc1OC(C)C |
| InChI | InChI=1S/C17H24F3NO3S/c1-11(2)24-16-8-7-15(9-12(16)3)25(22,23)21-14-6-4-5-13(10-14)17(18,19)20/h7-9,11,13-14,21H,4-6,10H2,1-3H3 |
| InChIKey | NDIXKFYPHHOHJH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |