C19H18N6O4S — CID 167188593
(5Z)-5-[[4-[(1,3-dimethyl-2-oxo-6-sulfanylidenepurin-7-yl)methyl]phenyl]methylidene]-6-hydroxy-1,3-diazinane-2,4-dione (PubChem CID 167188593) has the molecular formula C19H18N6O4S and a molecular weight of 426.46 g/mol. Its IUPAC name is (5Z)-5-[[4-[(1,3-dimethyl-2-oxo-6-sulfanylidenepurin-7-yl)methyl]phenyl]methylidene]-6-hydroxy-1,3-diazinane-2,4-dione.
| Compound Name | (5Z)-5-[[4-[(1,3-dimethyl-2-oxo-6-sulfanylidenepurin-7-yl)methyl]phenyl]methylidene]-6-hydroxy-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 167188593 |
| Molecular Formula | C19H18N6O4S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | (5Z)-5-[[4-[(1,3-dimethyl-2-oxo-6-sulfanylidenepurin-7-yl)methyl]phenyl]methylidene]-6-hydroxy-1,3-diazinane-2,4-dione |
| SMILES | Cn1c(=S)c2c(ncn2Cc2ccc(/C=C3\C(=O)NC(=O)NC3O)cc2)n(C)c1=O |
| InChI | InChI=1S/C19H18N6O4S/c1-23-14-13(17(30)24(2)19(23)29)25(9-20-14)8-11-5-3-10(4-6-11)7-12-15(26)21-18(28)22-16(12)27/h3-7,9,15,26H,8H2,1-2H3,(H2,21,22,27,28)/b12-7- |
| InChIKey | XWCRXPSUGURIBR-GHXNOFRVSA-N |
| XLogP | 0.39 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|