C19H18N6O5 — CID 167133205
7-[[4-[(E)-(4-hydroxy-2,6-dioxo-1,3-diazinan-5-ylidene)methyl]phenyl]methyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 167133205) has the molecular formula C19H18N6O5 and a molecular weight of 410.39 g/mol. Its IUPAC name is 7-[[4-[(E)-(4-hydroxy-2,6-dioxo-1,3-diazinan-5-ylidene)methyl]phenyl]methyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[[4-[(E)-(4-hydroxy-2,6-dioxo-1,3-diazinan-5-ylidene)methyl]phenyl]methyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 167133205 |
| Molecular Formula | C19H18N6O5 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 7-[[4-[(E)-(4-hydroxy-2,6-dioxo-1,3-diazinan-5-ylidene)methyl]phenyl]methyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2Cc2ccc(/C=C3/C(=O)NC(=O)NC3O)cc2)n(C)c1=O |
| InChI | InChI=1S/C19H18N6O5/c1-23-14-13(17(28)24(2)19(23)30)25(9-20-14)8-11-5-3-10(4-6-11)7-12-15(26)21-18(29)22-16(12)27/h3-7,9,15,26H,8H2,1-2H3,(H2,21,22,27,29)/b12-7+ |
| InChIKey | QPIOWYOMJZURDM-KPKJPENVSA-N |
| XLogP | -0.98 |
| TPSA | 140.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|