C18H16N6O2S2 — CID 164804701
1,3-dimethyl-7-[[4-[(Z)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl]methyl]-6-sulfanylidenepurin-2-one (PubChem CID 164804701) has the molecular formula C18H16N6O2S2 and a molecular weight of 412.50 g/mol. Its IUPAC name is 1,3-dimethyl-7-[[4-[(Z)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl]methyl]-6-sulfanylidenepurin-2-one.
| Compound Name | 1,3-dimethyl-7-[[4-[(Z)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl]methyl]-6-sulfanylidenepurin-2-one |
|---|---|
| PubChem CID | 164804701 |
| Molecular Formula | C18H16N6O2S2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 1,3-dimethyl-7-[[4-[(Z)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl]methyl]-6-sulfanylidenepurin-2-one |
| SMILES | Cn1c(=S)c2c(ncn2Cc2ccc(/C=C3\NC(=S)NC3=O)cc2)n(C)c1=O |
| InChI | InChI=1S/C18H16N6O2S2/c1-22-14-13(16(27)23(2)18(22)26)24(9-19-14)8-11-5-3-10(4-6-11)7-12-15(25)21-17(28)20-12/h3-7,9H,8H2,1-2H3,(H2,20,21,25,28)/b12-7- |
| InChIKey | LLKXQNGOMJEKRG-GHXNOFRVSA-N |
| XLogP | 1.20 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|