C19H17N5O2S2 — CID 164952474
1,3-dimethyl-7-[[4-[(Z)-(3-oxo-5-sulfanylidenepyrrolidin-2-ylidene)methyl]phenyl]methyl]-6-sulfanylidenepurin-2-one (PubChem CID 164952474) has the molecular formula C19H17N5O2S2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 1,3-dimethyl-7-[[4-[(Z)-(3-oxo-5-sulfanylidenepyrrolidin-2-ylidene)methyl]phenyl]methyl]-6-sulfanylidenepurin-2-one.
| Compound Name | 1,3-dimethyl-7-[[4-[(Z)-(3-oxo-5-sulfanylidenepyrrolidin-2-ylidene)methyl]phenyl]methyl]-6-sulfanylidenepurin-2-one |
|---|---|
| PubChem CID | 164952474 |
| Molecular Formula | C19H17N5O2S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 1,3-dimethyl-7-[[4-[(Z)-(3-oxo-5-sulfanylidenepyrrolidin-2-ylidene)methyl]phenyl]methyl]-6-sulfanylidenepurin-2-one |
| SMILES | Cn1c(=S)c2c(ncn2Cc2ccc(/C=C3\NC(=S)CC3=O)cc2)n(C)c1=O |
| InChI | InChI=1S/C19H17N5O2S2/c1-22-17-16(18(28)23(2)19(22)26)24(10-20-17)9-12-5-3-11(4-6-12)7-13-14(25)8-15(27)21-13/h3-7,10H,8-9H2,1-2H3,(H,21,27)/b13-7- |
| InChIKey | FVPSSJPCFDYNFZ-QPEQYQDCSA-N |
| XLogP | 2.08 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|