C12H11ClN4O2S — CID 47110926
7-[(5-chlorothiophen-2-yl)methyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 47110926) has the molecular formula C12H11ClN4O2S and a molecular weight of 310.77 g/mol. Its IUPAC name is 7-[(5-chlorothiophen-2-yl)methyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(5-chlorothiophen-2-yl)methyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 47110926 |
| Molecular Formula | C12H11ClN4O2S |
| Molecular Weight | 310.77 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 7-[(5-chlorothiophen-2-yl)methyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2Cc2ccc(Cl)s2)n(C)c1=O |
| InChI | InChI=1S/C12H11ClN4O2S/c1-15-10-9(11(18)16(2)12(15)19)17(6-14-10)5-7-3-4-8(13)20-7/h3-4,6H,5H2,1-2H3 |
| InChIKey | HNVJCUZZYBBXBY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.77 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |