C19H20N6O2 — CID 110176704
1,3-dimethyl-7-[3-(2-phenylimidazol-1-yl)propyl]purine-2,6-dione (PubChem CID 110176704) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is 1,3-dimethyl-7-[3-(2-phenylimidazol-1-yl)propyl]purine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-[3-(2-phenylimidazol-1-yl)propyl]purine-2,6-dione |
|---|---|
| PubChem CID | 110176704 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 1,3-dimethyl-7-[3-(2-phenylimidazol-1-yl)propyl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CCCn2ccnc2-c2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C19H20N6O2/c1-22-17-15(18(26)23(2)19(22)27)25(13-21-17)11-6-10-24-12-9-20-16(24)14-7-4-3-5-8-14/h3-5,7-9,12-13H,6,10-11H2,1-2H3 |
| InChIKey | VJOWZGGEFGSVEM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 79.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |