C18H24ClN5O5 — CID 110176054
[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]-[1-(1,3-dimethyl-2,6-dioxopurin-7-yl)propan-2-yl]azanium chloride (PubChem CID 110176054) has the molecular formula C18H24ClN5O5 and a molecular weight of 425.87 g/mol. Its IUPAC name is [2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]-[1-(1,3-dimethyl-2,6-dioxopurin-7-yl)propan-2-yl]azanium chloride.
| Compound Name | [2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]-[1-(1,3-dimethyl-2,6-dioxopurin-7-yl)propan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 110176054 |
| Molecular Formula | C18H24ClN5O5 |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | [2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]-[1-(1,3-dimethyl-2,6-dioxopurin-7-yl)propan-2-yl]azanium chloride |
| SMILES | CC(Cn1cnc2c1c(=O)n(C)c(=O)n2C)[NH2+]CC(O)c1ccc(O)c(O)c1.[Cl-] |
| InChI | InChI=1S/C18H23N5O5.ClH/c1-10(19-7-14(26)11-4-5-12(24)13(25)6-11)8-23-9-20-16-15(23)17(27)22(3)18(28)21(16)2;/h4-6,9-10,14,19,24-26H,7-8H2,1-3H3;1H |
| InChIKey | QFITVRFDXUWNAZ-UHFFFAOYSA-N |
| XLogP | -4.47 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | -4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|