C16H18ClN5O3 — CID 1084991
7-[(2R)-3-(3-chloroanilino)-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 1084991) has the molecular formula C16H18ClN5O3 and a molecular weight of 363.81 g/mol. Its IUPAC name is 7-[(2R)-3-(3-chloroanilino)-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(2R)-3-(3-chloroanilino)-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 1084991 |
| Molecular Formula | C16H18ClN5O3 |
| Molecular Weight | 363.81 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 7-[(2R)-3-(3-chloroanilino)-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2C[C@H](O)CNc2cccc(Cl)c2)n(C)c1=O |
| InChI | InChI=1S/C16H18ClN5O3/c1-20-14-13(15(24)21(2)16(20)25)22(9-19-14)8-12(23)7-18-11-5-3-4-10(17)6-11/h3-6,9,12,18,23H,7-8H2,1-2H3/t12-/m1/s1 |
| InChIKey | XWMOBHCCHHWOME-GFCCVEGCSA-N |
| XLogP | 0.56 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.81 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |