C20H23N3O2 — CID 90556350
3-(4-methoxyphenyl)-N-(3-pyrrolo[2,3-b]pyridin-1-ylpropyl)propanamide (PubChem CID 90556350) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N-(3-pyrrolo[2,3-b]pyridin-1-ylpropyl)propanamide.
| Compound Name | 3-(4-methoxyphenyl)-N-(3-pyrrolo[2,3-b]pyridin-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 90556350 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 3-(4-methoxyphenyl)-N-(3-pyrrolo[2,3-b]pyridin-1-ylpropyl)propanamide |
| SMILES | COc1ccc(CCC(=O)NCCCn2ccc3cccnc32)cc1 |
| InChI | InChI=1S/C20H23N3O2/c1-25-18-8-5-16(6-9-18)7-10-19(24)21-13-3-14-23-15-11-17-4-2-12-22-20(17)23/h2,4-6,8-9,11-12,15H,3,7,10,13-14H2,1H3,(H,21,24) |
| InChIKey | AMSHJRCPZAJFHR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|