C27H42N2O3 — CID 19452718
5-[(2,5-dimethylphenoxy)methyl]-N-[1-(dipentylamino)propan-2-yl]furan-2-carboxamide (PubChem CID 19452718) has the molecular formula C27H42N2O3 and a molecular weight of 442.64 g/mol. Its IUPAC name is 5-[(2,5-dimethylphenoxy)methyl]-N-[1-(dipentylamino)propan-2-yl]furan-2-carboxamide.
| Compound Name | 5-[(2,5-dimethylphenoxy)methyl]-N-[1-(dipentylamino)propan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19452718 |
| Molecular Formula | C27H42N2O3 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.32 |
| IUPAC Name | 5-[(2,5-dimethylphenoxy)methyl]-N-[1-(dipentylamino)propan-2-yl]furan-2-carboxamide |
| SMILES | CCCCCN(CCCCC)CC(C)NC(=O)c1ccc(COc2cc(C)ccc2C)o1 |
| InChI | InChI=1S/C27H42N2O3/c1-6-8-10-16-29(17-11-9-7-2)19-23(5)28-27(30)25-15-14-24(32-25)20-31-26-18-21(3)12-13-22(26)4/h12-15,18,23H,6-11,16-17,19-20H2,1-5H3,(H,28,30) |
| InChIKey | UURFTWXEXYEUOC-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|