C23H28N2O4 — CID 110280110
N-[1-[bis(prop-2-enyl)amino]-1-oxopropan-2-yl]-5-[(2,5-dimethylphenoxy)methyl]furan-2-carboxamide (PubChem CID 110280110) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[1-[bis(prop-2-enyl)amino]-1-oxopropan-2-yl]-5-[(2,5-dimethylphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-[bis(prop-2-enyl)amino]-1-oxopropan-2-yl]-5-[(2,5-dimethylphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 110280110 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-[1-[bis(prop-2-enyl)amino]-1-oxopropan-2-yl]-5-[(2,5-dimethylphenoxy)methyl]furan-2-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)C(C)NC(=O)c1ccc(COc2cc(C)ccc2C)o1 |
| InChI | InChI=1S/C23H28N2O4/c1-6-12-25(13-7-2)23(27)18(5)24-22(26)20-11-10-19(29-20)15-28-21-14-16(3)8-9-17(21)4/h6-11,14,18H,1-2,12-13,15H2,3-5H3,(H,24,26) |
| InChIKey | VUZUYADGJZTOSF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|