C16H17Cl2NO3 — CID 19415847
N-butyl-5-[(2,3-dichlorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19415847) has the molecular formula C16H17Cl2NO3 and a molecular weight of 342.22 g/mol. Its IUPAC name is N-butyl-5-[(2,3-dichlorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-butyl-5-[(2,3-dichlorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19415847 |
| Molecular Formula | C16H17Cl2NO3 |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | N-butyl-5-[(2,3-dichlorophenoxy)methyl]furan-2-carboxamide |
| SMILES | CCCCNC(=O)c1ccc(COc2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C16H17Cl2NO3/c1-2-3-9-19-16(20)14-8-7-11(22-14)10-21-13-6-4-5-12(17)15(13)18/h4-8H,2-3,9-10H2,1H3,(H,19,20) |
| InChIKey | WWXYHXVIEBHZCU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|