C18H22N2O5 — CID 19446298
N-hexyl-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 19446298) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is N-hexyl-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-hexyl-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19446298 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-hexyl-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | CCCCCCNC(=O)c1ccc(COc2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C18H22N2O5/c1-2-3-4-7-12-19-18(21)17-11-10-14(25-17)13-24-16-9-6-5-8-15(16)20(22)23/h5-6,8-11H,2-4,7,12-13H2,1H3,(H,19,21) |
| InChIKey | HELCWOBYBKAVEE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|