C17H17Cl2NO5S — CID 19415733
ethyl (2R)-2-[[5-[(2,3-dichlorophenoxy)methyl]furan-2-carbonyl]amino]-3-sulfanylpropanoate (PubChem CID 19415733) has the molecular formula C17H17Cl2NO5S and a molecular weight of 418.30 g/mol. Its IUPAC name is ethyl (2R)-2-[[5-[(2,3-dichlorophenoxy)methyl]furan-2-carbonyl]amino]-3-sulfanylpropanoate.
| Compound Name | ethyl (2R)-2-[[5-[(2,3-dichlorophenoxy)methyl]furan-2-carbonyl]amino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 19415733 |
| Molecular Formula | C17H17Cl2NO5S |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | ethyl (2R)-2-[[5-[(2,3-dichlorophenoxy)methyl]furan-2-carbonyl]amino]-3-sulfanylpropanoate |
| SMILES | CCOC(=O)[C@H](CS)NC(=O)c1ccc(COc2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C17H17Cl2NO5S/c1-2-23-17(22)12(9-26)20-16(21)14-7-6-10(25-14)8-24-13-5-3-4-11(18)15(13)19/h3-7,12,26H,2,8-9H2,1H3,(H,20,21)/t12-/m0/s1 |
| InChIKey | CCVFFERCNDBHAH-LBPRGKRZSA-N |
| XLogP | 3.76 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|