C15H16ClNO3 — CID 91938782
N-butyl-5-(2-chlorophenoxy)furan-2-carboxamide (PubChem CID 91938782) has the molecular formula C15H16ClNO3 and a molecular weight of 293.75 g/mol. Its IUPAC name is N-butyl-5-(2-chlorophenoxy)furan-2-carboxamide.
| Compound Name | N-butyl-5-(2-chlorophenoxy)furan-2-carboxamide |
|---|---|
| PubChem CID | 91938782 |
| Molecular Formula | C15H16ClNO3 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-butyl-5-(2-chlorophenoxy)furan-2-carboxamide |
| SMILES | CCCCNC(=O)c1ccc(Oc2ccccc2Cl)o1 |
| InChI | InChI=1S/C15H16ClNO3/c1-2-3-10-17-15(18)13-8-9-14(20-13)19-12-7-5-4-6-11(12)16/h4-9H,2-3,10H2,1H3,(H,17,18) |
| InChIKey | OTRMSXUWAZAUEV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|