C22H27ClN2O4 — CID 91957682
5-(2-chlorophenoxy)-N-[[4-(pyrrolidin-1-ylmethyl)oxan-4-yl]methyl]furan-2-carboxamide (PubChem CID 91957682) has the molecular formula C22H27ClN2O4 and a molecular weight of 418.92 g/mol. Its IUPAC name is 5-(2-chlorophenoxy)-N-[[4-(pyrrolidin-1-ylmethyl)oxan-4-yl]methyl]furan-2-carboxamide.
| Compound Name | 5-(2-chlorophenoxy)-N-[[4-(pyrrolidin-1-ylmethyl)oxan-4-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 91957682 |
| Molecular Formula | C22H27ClN2O4 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 5-(2-chlorophenoxy)-N-[[4-(pyrrolidin-1-ylmethyl)oxan-4-yl]methyl]furan-2-carboxamide |
| SMILES | O=C(NCC1(CN2CCCC2)CCOCC1)c1ccc(Oc2ccccc2Cl)o1 |
| InChI | InChI=1S/C22H27ClN2O4/c23-17-5-1-2-6-18(17)28-20-8-7-19(29-20)21(26)24-15-22(9-13-27-14-10-22)16-25-11-3-4-12-25/h1-2,5-8H,3-4,9-16H2,(H,24,26) |
| InChIKey | BKOJFIFNBZZZSH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |