C15H17NO3 — CID 127265058
N-butyl-5-phenoxyfuran-2-carboxamide (PubChem CID 127265058) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is N-butyl-5-phenoxyfuran-2-carboxamide.
| Compound Name | N-butyl-5-phenoxyfuran-2-carboxamide |
|---|---|
| PubChem CID | 127265058 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-butyl-5-phenoxyfuran-2-carboxamide |
| SMILES | CCCCNC(=O)c1ccc(Oc2ccccc2)o1 |
| InChI | InChI=1S/C15H17NO3/c1-2-3-11-16-15(17)13-9-10-14(19-13)18-12-7-5-4-6-8-12/h4-10H,2-3,11H2,1H3,(H,16,17) |
| InChIKey | HOGTUWRHGITUKR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|