C26H33N2O3+ — CID 7218719
benzyl-[(4-methoxyphenyl)methyl]-[[5-(pentylcarbamoyl)furan-2-yl]methyl]azanium (PubChem CID 7218719) has the molecular formula C26H33N2O3+ and a molecular weight of 421.56 g/mol. Its IUPAC name is benzyl-[(4-methoxyphenyl)methyl]-[[5-(pentylcarbamoyl)furan-2-yl]methyl]azanium.
| Compound Name | benzyl-[(4-methoxyphenyl)methyl]-[[5-(pentylcarbamoyl)furan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 7218719 |
| Molecular Formula | C26H33N2O3+ |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | benzyl-[(4-methoxyphenyl)methyl]-[[5-(pentylcarbamoyl)furan-2-yl]methyl]azanium |
| SMILES | CCCCCNC(=O)c1ccc(C[NH+](Cc2ccccc2)Cc2ccc(OC)cc2)o1 |
| InChI | InChI=1S/C26H32N2O3/c1-3-4-8-17-27-26(29)25-16-15-24(31-25)20-28(18-21-9-6-5-7-10-21)19-22-11-13-23(30-2)14-12-22/h5-7,9-16H,3-4,8,17-20H2,1-2H3,(H,27,29)/p+1 |
| InChIKey | LRVUESMGPROJHU-UHFFFAOYSA-O |
| XLogP | 3.99 |
| TPSA | 55.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|