C24H29N2O4+ — CID 7296563
benzyl-[[5-(2-methoxyethylcarbamoyl)furan-2-yl]methyl]-[(3-methoxyphenyl)methyl]azanium (PubChem CID 7296563) has the molecular formula C24H29N2O4+ and a molecular weight of 409.51 g/mol. Its IUPAC name is benzyl-[[5-(2-methoxyethylcarbamoyl)furan-2-yl]methyl]-[(3-methoxyphenyl)methyl]azanium.
| Compound Name | benzyl-[[5-(2-methoxyethylcarbamoyl)furan-2-yl]methyl]-[(3-methoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7296563 |
| Molecular Formula | C24H29N2O4+ |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | benzyl-[[5-(2-methoxyethylcarbamoyl)furan-2-yl]methyl]-[(3-methoxyphenyl)methyl]azanium |
| SMILES | COCCNC(=O)c1ccc(C[NH+](Cc2ccccc2)Cc2cccc(OC)c2)o1 |
| InChI | InChI=1S/C24H28N2O4/c1-28-14-13-25-24(27)23-12-11-22(30-23)18-26(16-19-7-4-3-5-8-19)17-20-9-6-10-21(15-20)29-2/h3-12,15H,13-14,16-18H2,1-2H3,(H,25,27)/p+1 |
| InChIKey | OUEJRXSDAGEEFN-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 65.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|