C17H21NO4 — CID 19463380
5-[(3,5-dimethylphenoxy)methyl]-N-(2-methoxyethyl)furan-2-carboxamide (PubChem CID 19463380) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is 5-[(3,5-dimethylphenoxy)methyl]-N-(2-methoxyethyl)furan-2-carboxamide.
| Compound Name | 5-[(3,5-dimethylphenoxy)methyl]-N-(2-methoxyethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19463380 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 5-[(3,5-dimethylphenoxy)methyl]-N-(2-methoxyethyl)furan-2-carboxamide |
| SMILES | COCCNC(=O)c1ccc(COc2cc(C)cc(C)c2)o1 |
| InChI | InChI=1S/C17H21NO4/c1-12-8-13(2)10-15(9-12)21-11-14-4-5-16(22-14)17(19)18-6-7-20-3/h4-5,8-10H,6-7,11H2,1-3H3,(H,18,19) |
| InChIKey | FXOCWFITWOCTLW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|