C16H19NO3S — CID 19450857
5-[(3,4-dimethylphenoxy)methyl]-N-(2-sulfanylethyl)furan-2-carboxamide (PubChem CID 19450857) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is 5-[(3,4-dimethylphenoxy)methyl]-N-(2-sulfanylethyl)furan-2-carboxamide.
| Compound Name | 5-[(3,4-dimethylphenoxy)methyl]-N-(2-sulfanylethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19450857 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 5-[(3,4-dimethylphenoxy)methyl]-N-(2-sulfanylethyl)furan-2-carboxamide |
| SMILES | Cc1ccc(OCc2ccc(C(=O)NCCS)o2)cc1C |
| InChI | InChI=1S/C16H19NO3S/c1-11-3-4-13(9-12(11)2)19-10-14-5-6-15(20-14)16(18)17-7-8-21/h3-6,9,21H,7-8,10H2,1-2H3,(H,17,18) |
| InChIKey | RCHOSVJSYADIOE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|