C22H22N2O4 — CID 19463236
N-(4-acetamidophenyl)-5-[(3,5-dimethylphenoxy)methyl]furan-2-carboxamide (PubChem CID 19463236) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-5-[(3,5-dimethylphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(4-acetamidophenyl)-5-[(3,5-dimethylphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19463236 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-(4-acetamidophenyl)-5-[(3,5-dimethylphenoxy)methyl]furan-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2ccc(COc3cc(C)cc(C)c3)o2)cc1 |
| InChI | InChI=1S/C22H22N2O4/c1-14-10-15(2)12-20(11-14)27-13-19-8-9-21(28-19)22(26)24-18-6-4-17(5-7-18)23-16(3)25/h4-12H,13H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | ZCRBKSDXOZQRES-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |