C15H16ClFN2O3 — CID 26317223
N-butyl-2-[(2-chloro-4-fluorophenoxy)methyl]-1,3-oxazole-4-carboxamide (PubChem CID 26317223) has the molecular formula C15H16ClFN2O3 and a molecular weight of 326.75 g/mol. Its IUPAC name is N-butyl-2-[(2-chloro-4-fluorophenoxy)methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-butyl-2-[(2-chloro-4-fluorophenoxy)methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 26317223 |
| Molecular Formula | C15H16ClFN2O3 |
| Molecular Weight | 326.75 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | N-butyl-2-[(2-chloro-4-fluorophenoxy)methyl]-1,3-oxazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1coc(COc2ccc(F)cc2Cl)n1 |
| InChI | InChI=1S/C15H16ClFN2O3/c1-2-3-6-18-15(20)12-8-22-14(19-12)9-21-13-5-4-10(17)7-11(13)16/h4-5,7-8H,2-3,6,9H2,1H3,(H,18,20) |
| InChIKey | QDZGAXXKTAYOMR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.75 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|