C21H15Cl2N3O4S — CID 4694940
3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[(4-methyl-2-nitrophenyl)carbamothioyl]prop-2-enamide (PubChem CID 4694940) has the molecular formula C21H15Cl2N3O4S and a molecular weight of 476.34 g/mol. Its IUPAC name is 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[(4-methyl-2-nitrophenyl)carbamothioyl]prop-2-enamide.
| Compound Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[(4-methyl-2-nitrophenyl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 4694940 |
| Molecular Formula | C21H15Cl2N3O4S |
| Molecular Weight | 476.34 g/mol |
| Exact Mass | 475.02 |
| IUPAC Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[(4-methyl-2-nitrophenyl)carbamothioyl]prop-2-enamide |
| SMILES | Cc1ccc(NC(=S)NC(=O)C=Cc2ccc(-c3cccc(Cl)c3Cl)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H15Cl2N3O4S/c1-12-5-8-16(17(11-12)26(28)29)24-21(31)25-19(27)10-7-13-6-9-18(30-13)14-3-2-4-15(22)20(14)23/h2-11H,1H3,(H2,24,25,27,31) |
| InChIKey | LCZMSPUEHUIDDF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.34 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|