C24H16ClNO3S — CID 18830468
N-[4-[(E)-3-[5-(2-chlorophenyl)furan-2-yl]prop-2-enoyl]phenyl]thiophene-2-carboxamide (PubChem CID 18830468) has the molecular formula C24H16ClNO3S and a molecular weight of 433.92 g/mol. Its IUPAC name is N-[4-[(E)-3-[5-(2-chlorophenyl)furan-2-yl]prop-2-enoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[(E)-3-[5-(2-chlorophenyl)furan-2-yl]prop-2-enoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 18830468 |
| Molecular Formula | C24H16ClNO3S |
| Molecular Weight | 433.92 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | N-[4-[(E)-3-[5-(2-chlorophenyl)furan-2-yl]prop-2-enoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccccc2Cl)o1)c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C24H16ClNO3S/c25-20-5-2-1-4-19(20)22-14-12-18(29-22)11-13-21(27)16-7-9-17(10-8-16)26-24(28)23-6-3-15-30-23/h1-15H,(H,26,28)/b13-11+ |
| InChIKey | PRIDJWGLBUBSIV-ACCUITESSA-N |
| XLogP | 6.81 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.92 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|