C24H15Cl2NO3S — CID 18830570
N-[3-[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]phenyl]thiophene-2-carboxamide (PubChem CID 18830570) has the molecular formula C24H15Cl2NO3S and a molecular weight of 468.36 g/mol. Its IUPAC name is N-[3-[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 18830570 |
| Molecular Formula | C24H15Cl2NO3S |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 467.01 |
| IUPAC Name | N-[3-[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1)c1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C24H15Cl2NO3S/c25-17-11-16(12-18(26)14-17)22-9-7-20(30-22)6-8-21(28)15-3-1-4-19(13-15)27-24(29)23-5-2-10-31-23/h1-14H,(H,27,29)/b8-6+ |
| InChIKey | UJAKRBITKKAJQV-SOFGYWHQSA-N |
| XLogP | 7.46 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|