C25H17Cl2NO4 — CID 18830572
N-[3-[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]phenyl]-2-methylfuran-3-carboxamide (PubChem CID 18830572) has the molecular formula C25H17Cl2NO4 and a molecular weight of 466.32 g/mol. Its IUPAC name is N-[3-[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]phenyl]-2-methylfuran-3-carboxamide.
| Compound Name | N-[3-[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]phenyl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 18830572 |
| Molecular Formula | C25H17Cl2NO4 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | N-[3-[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]phenyl]-2-methylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)Nc1cccc(C(=O)/C=C/c2ccc(-c3cc(Cl)cc(Cl)c3)o2)c1 |
| InChI | InChI=1S/C25H17Cl2NO4/c1-15-22(9-10-31-15)25(30)28-20-4-2-3-16(13-20)23(29)7-5-21-6-8-24(32-21)17-11-18(26)14-19(27)12-17/h2-14H,1H3,(H,28,30)/b7-5+ |
| InChIKey | VGVPLSIMYIGEEG-FNORWQNLSA-N |
| XLogP | 7.30 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|