C19H12Cl2O2 — CID 5349050
(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-1-phenylprop-2-en-1-one (PubChem CID 5349050) has the molecular formula C19H12Cl2O2 and a molecular weight of 343.21 g/mol. Its IUPAC name is (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-1-phenylprop-2-en-1-one.
| Compound Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 5349050 |
| Molecular Formula | C19H12Cl2O2 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-1-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1)c1ccccc1 |
| InChI | InChI=1S/C19H12Cl2O2/c20-15-10-14(11-16(21)12-15)19-9-7-17(23-19)6-8-18(22)13-4-2-1-3-5-13/h1-12H/b8-6+ |
| InChIKey | RHTQNMZZPACPJI-SOFGYWHQSA-N |
| XLogP | 6.15 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|